![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
(ghost) |
20-Apr-2018 16:20 |
- |
|
 |
138 |
20-Apr-2018 16:20 |
- |
|
 |
1914 |
20-Apr-2018 16:20 |
- |
|
 |
A$AP Rocky feat. BlocBoy JB |
20-Apr-2018 16:20 |
- |
|
 |
AT0SHIMA 3RR0R |
20-Apr-2018 16:20 |
- |
|
 |
Acrid Abeyance |
20-Apr-2018 16:20 |
- |
|
 |
Aghast! |
20-Apr-2018 16:20 |
- |
|
 |
Alan Hovhaness; Central Washington University Wind Ensemble, Larry Gookin, Keith Brion, Mark Goodenberger |
20-Apr-2018 16:20 |
- |
|
 |
Alaska |
20-Apr-2018 16:20 |
- |
|
 |
Alcione |
20-Apr-2018 16:20 |
- |
|
 |
Alejandro Vera Blues |
20-Apr-2018 16:20 |
- |
|
 |
Alessandra Celletti |
20-Apr-2018 16:20 |
- |
|
 |
Alic |
20-Apr-2018 16:20 |
- |
|
 |
Alireza Ghomayshi |
20-Apr-2018 16:20 |
- |
|
 |
Alkibar Gignor |
20-Apr-2018 16:20 |
- |
|
 |
All Them Witches |
20-Apr-2018 16:20 |
- |
|
 |
Altar of Betelgeuze |
20-Apr-2018 16:20 |
- |
|
 |
Animal Drive |
20-Apr-2018 16:20 |
- |
|
 |
Anja & Wilhelm Tell Boys |
20-Apr-2018 16:20 |
- |
|
 |
Anon |
20-Apr-2018 16:20 |
- |
|
 |
Bad Riders |
20-Apr-2018 16:20 |
- |
|
 |
Balladur |
20-Apr-2018 16:20 |
- |
|
 |
Bear McCreary |
20-Apr-2018 16:20 |
- |
|
 |
Bernie Senensky, Gene Perla, Ben Riley |
20-Apr-2018 16:20 |
- |
|
 |
Big Gus and Swampadelic |
20-Apr-2018 16:20 |
- |
|
 |
Black Moth |
20-Apr-2018 16:20 |
- |
|
 |
Blee vs ClassyMenace |
20-Apr-2018 16:20 |
- |
|
 |
Blinddryve |
20-Apr-2018 16:20 |
- |
|
 |
Blue Sky Black Death presents The Holocaust |
20-Apr-2018 16:20 |
- |
|
 |
Bonelang |
20-Apr-2018 16:20 |
- |
|
 |
Brahms, Schubert; Silvia Chiesa, Maurizio Baglini |
20-Apr-2018 16:20 |
- |
|
 |
Brett Anderson |
20-Apr-2018 16:20 |
- |
|
 |
Bridgette Bryant |
20-Apr-2018 16:20 |
- |
|
 |
Buck Biloxi and The Fucks ⁄ Microsoft Paint |
20-Apr-2018 16:20 |
- |
|
 |
Bus Stop |
20-Apr-2018 16:20 |
- |
|
 |
Charles‐Marie Widor, Louis Vierne; Simon Preston |
20-Apr-2018 16:20 |
- |
|
 |
Chekara |
20-Apr-2018 16:20 |
- |
|
 |
Cherry aka BreakNtune & Da Phunk |
20-Apr-2018 16:20 |
- |
|
 |
Claire Bergerault |
20-Apr-2018 16:20 |
- |
|
 |
Coronel |
20-Apr-2018 16:20 |
- |
|
 |
Corpora |
20-Apr-2018 16:20 |
- |
|
 |
Cosmic Lights |
20-Apr-2018 16:20 |
- |
|
 |
Coverdale • Page |
20-Apr-2018 16:20 |
- |
|
 |
Crazy As Pinoy |
20-Apr-2018 16:20 |
- |
|
 |
César Franck; Wiener Philharmoniker, Paul Crossley, Carlo Maria Giulini |
20-Apr-2018 16:20 |
- |
|
 |
C‐Dubb Presents Mac Reese |
20-Apr-2018 16:20 |
- |
|
 |
DG 307 |
20-Apr-2018 16:20 |
- |
|
 |
Da Uptown Crew |
20-Apr-2018 16:20 |
- |
|
 |
Darediablo |
20-Apr-2018 16:20 |
- |
|
 |
Dario Campeotto |
20-Apr-2018 16:20 |
- |
|
 |
Dave McKean |
20-Apr-2018 16:20 |
- |
|
 |
David Gorman |
20-Apr-2018 16:20 |
- |
|
 |
David McNeil |
20-Apr-2018 16:20 |
- |
|
 |
David Smith & Rebecca Vicary |
20-Apr-2018 16:20 |
- |
|
 |
Daydream XI |
20-Apr-2018 16:20 |
- |
|
 |
Dear Pariah |
20-Apr-2018 16:20 |
- |
|
 |
Degial |
20-Apr-2018 16:20 |
- |
|
 |
Dozer |
20-Apr-2018 16:20 |
- |
|
 |
Eden Studios |
20-Apr-2018 16:20 |
- |
|
 |
Elgar, Brahms; Leopold Stokowski |
20-Apr-2018 16:20 |
- |
|
 |
Elinor Frey, David Fung |
20-Apr-2018 16:20 |
- |
|
 |
Erik Satie; Johannes Cernota |
20-Apr-2018 16:20 |
- |
|
 |
Eskapisten |
20-Apr-2018 16:20 |
- |
|
 |
Falloch |
20-Apr-2018 16:20 |
- |
|
 |
Fates Warning |
20-Apr-2018 16:20 |
- |
|
 |
Field Report |
20-Apr-2018 16:20 |
- |
|
 |
Fourteen 14 ⁄ Pianonegro |
20-Apr-2018 16:20 |
- |
|
 |
Fox Academy |
20-Apr-2018 16:20 |
- |
|
 |
Franz Schubert; Andreas Staier, Daniel Sepec, Roel Dieltiens |
20-Apr-2018 16:20 |
- |
|
 |
Freddie Gibbs |
20-Apr-2018 16:20 |
- |
|
 |
Gabriel Fauré; Alban Gerhardt, Cécile Licad |
20-Apr-2018 16:20 |
- |
|
 |
Gareth Thomas |
20-Apr-2018 16:20 |
- |
|
 |
Gary Numan |
20-Apr-2018 16:20 |
- |
|
 |
Gary Numan & Ade Fenton |
20-Apr-2018 16:20 |
- |
|
 |
Globi |
20-Apr-2018 16:20 |
- |
|
 |
Gruppo di Improvvisazione Nuova Consonanza |
20-Apr-2018 16:20 |
- |
|
 |
Gustav Holst & Sir William Walton |
20-Apr-2018 16:20 |
- |
|
 |
Göteborgs Symfoniker, Neeme Järvi |
20-Apr-2018 16:20 |
- |
|
 |
Halasan Bazar |
20-Apr-2018 16:20 |
- |
|
 |
Harper Lee read by Sissy Spacek |
20-Apr-2018 16:20 |
- |
|
 |
Headhunterz vs Wildstylez |
20-Apr-2018 16:20 |
- |
|
 |
Henny Huisman en Soundmixers Voor Zonnebloem |
20-Apr-2018 16:20 |
- |
|
 |
Hernando |
20-Apr-2018 16:20 |
- |
|
 |
Hidrolic West feat. C-Bo, King Locust, Twan G, P3 & Shoddy Boi |
20-Apr-2018 16:20 |
- |
|
 |
Hindemith; Dietrich Fischer‐Dieskau, Elisabeth Söderström, Leonore Kirschstein, Donald Grobe, Joseph Keilberth |
20-Apr-2018 16:20 |
- |
|
 |
Homo-Demen |
20-Apr-2018 16:20 |
- |
|
 |
Iiro Rantala |
20-Apr-2018 16:20 |
- |
|
 |
Ill Conscious |
20-Apr-2018 16:20 |
- |
|
 |
Illumenium |
20-Apr-2018 16:20 |
- |
|
 |
Incise |
20-Apr-2018 16:20 |
- |
|
 |
Irving Joseph |
20-Apr-2018 16:20 |
- |
|
 |
J-Ax & Fedez |
20-Apr-2018 16:20 |
- |
|
 |
J.J. Johnson ⁄ Dominic Frontiere |
20-Apr-2018 16:20 |
- |
|
 |
J.S. Bach; Marie‐Claire Alain |
20-Apr-2018 16:20 |
- |
|
 |
JJUUJJUU |
20-Apr-2018 16:20 |
- |
|
 |
Jason Nevins vs. The Krew |
20-Apr-2018 16:20 |
- |
|
 |
Jawbone |
20-Apr-2018 16:20 |
- |
|
 |
Jelly Roll Morton |
20-Apr-2018 16:20 |
- |
|
 |
Jerry O’Sullivan |
20-Apr-2018 16:20 |
- |
|
 |
Jerry Raye featuring Fenwyck |
20-Apr-2018 16:20 |
- |
|
 |
Jochen Feucht Quartett |
20-Apr-2018 16:20 |
- |
|
 |
Joe Pass & J.J. Johnson |
20-Apr-2018 16:20 |
- |
|
 |
Johann Jacob Froberger; Bob van Asperen |
20-Apr-2018 16:20 |
- |
|
 |
Johann Sebastian Bach, César Franck; Michael Murray |
20-Apr-2018 16:20 |
- |
|
 |
John Cage, Sylvano Bussotti; Paolo Carlini, Mauro Castellano |
20-Apr-2018 16:20 |
- |
|
 |
John Duncan & Cosey Fanni-Tutti & Chris Carter |
20-Apr-2018 16:20 |
- |
|
 |
Johnny Carbonaras |
20-Apr-2018 16:20 |
- |
|
 |
Joseph Haydn; Stefano Montanari, Accademia Bizantina & Ottavio Dantone |
20-Apr-2018 16:20 |
- |
|
 |
Josh Lawrence |
20-Apr-2018 16:20 |
- |
|
 |
Junior C Reaction |
20-Apr-2018 16:20 |
- |
|
 |
Kabani |
20-Apr-2018 16:20 |
- |
|
 |
Kevin Dippold & The Float Associates |
20-Apr-2018 16:20 |
- |
|
 |
Kinto Sol |
20-Apr-2018 16:20 |
- |
|
 |
Kodak Black & Plies |
20-Apr-2018 16:20 |
- |
|
 |
Kuranes |
20-Apr-2018 16:20 |
- |
|
 |
La Bouquet |
20-Apr-2018 16:20 |
- |
|
 |
Lacertilia |
20-Apr-2018 16:20 |
- |
|
 |
Lake Michigan |
20-Apr-2018 16:20 |
- |
|
 |
Lana Del Rey |
20-Apr-2018 16:20 |
- |
|
 |
Leg Puppy |
20-Apr-2018 16:20 |
- |
|
 |
Les Tontons Flingueurs |
20-Apr-2018 16:20 |
- |
|
 |
Levent Yüksel |
20-Apr-2018 16:20 |
- |
|
 |
Lex van Someren |
20-Apr-2018 16:20 |
- |
|
 |
Licht |
20-Apr-2018 16:20 |
- |
|
 |
Liesbeth List & Ramses Shaffy |
20-Apr-2018 16:20 |
- |
|
 |
Lil Xan |
20-Apr-2018 16:20 |
- |
|
 |
Ludwig Sebus |
20-Apr-2018 16:20 |
- |
|
 |
Lyra's Legacy |
20-Apr-2018 16:20 |
- |
|
 |
Mahler; Christoph von Dohnányi, Dawn Upshaw, Cleveland Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Mana Source |
20-Apr-2018 16:20 |
- |
|
 |
Manian |
20-Apr-2018 16:20 |
- |
|
 |
Manuel Mucua |
20-Apr-2018 16:20 |
- |
|
 |
Marie-José |
20-Apr-2018 16:20 |
- |
|
 |
Mario Bautista & De La Ghetto |
20-Apr-2018 16:20 |
- |
|
 |
Martire⁄Throneum |
20-Apr-2018 16:20 |
- |
|
 |
Merle Haggard & The Strangers |
20-Apr-2018 16:20 |
- |
|
 |
Michel Delpech |
20-Apr-2018 16:20 |
- |
|
 |
Michel Petrucciani, Bob Malach |
20-Apr-2018 16:20 |
- |
|
 |
Milt Jackson, Al Cohn, J.J. Johnson, Kai Winding |
20-Apr-2018 16:20 |
- |
|
 |
Mirage |
20-Apr-2018 16:20 |
- |
|
 |
Mordecai Mapper ⁄Boston Brass Band ⁄ Cowz II |
20-Apr-2018 16:20 |
- |
|
 |
Mosaic |
20-Apr-2018 16:20 |
- |
|
 |
Mozart; The Italian Quartet with Antoine de Bavier |
20-Apr-2018 16:20 |
- |
|
 |
My Girl The River |
20-Apr-2018 16:20 |
- |
|
 |
NAK Trio |
20-Apr-2018 16:20 |
- |
|
 |
NSD |
20-Apr-2018 16:20 |
- |
|
 |
Nate Jones Band |
20-Apr-2018 16:20 |
- |
|
 |
Neonsol |
20-Apr-2018 16:20 |
- |
|
 |
Neutro Shorty |
20-Apr-2018 16:20 |
- |
|
 |
Nice Cold Nation |
20-Apr-2018 16:20 |
- |
|
 |
Nick Jonas feat. Anne‐Marie & Mike Posner |
20-Apr-2018 16:20 |
- |
|
 |
Nicole Rieu |
20-Apr-2018 16:20 |
- |
|
 |
Nocturnal Triumph |
20-Apr-2018 16:20 |
- |
|
 |
North Texas Wind Symphony, Eugene Corporon |
20-Apr-2018 16:20 |
- |
|
 |
Oliver Twizt feat. TRYON |
20-Apr-2018 16:20 |
- |
|
 |
Olivier Messiaen; Daniel Beilschmidt |
20-Apr-2018 16:20 |
- |
|
 |
Orchid Fixation |
20-Apr-2018 16:20 |
- |
|
 |
Orlando Gibbons; Jordi Savall, Christophe Coin, Sergi Casademunt, Johannes Sonnleitner |
20-Apr-2018 16:20 |
- |
|
 |
Oscar Woods & Black Ace |
20-Apr-2018 16:20 |
- |
|
 |
Our Place of Worship Is Silence |
20-Apr-2018 16:20 |
- |
|
 |
Palestrina; Pro Cantione Antiqua, Bruno Turner |
20-Apr-2018 16:20 |
- |
|
 |
Pantastic Steelband |
20-Apr-2018 16:20 |
- |
|
 |
Pat Cash |
20-Apr-2018 16:20 |
- |
|
 |
Paul Corley |
20-Apr-2018 16:20 |
- |
|
 |
Perception Cleanse Perception |
20-Apr-2018 16:20 |
- |
|
 |
Phenomenal Sun |
20-Apr-2018 16:20 |
- |
|
 |
Philippe Jacquis |
20-Apr-2018 16:20 |
- |
|
 |
Pierre Akendengué |
20-Apr-2018 16:20 |
- |
|
 |
Pol Nada |
20-Apr-2018 16:20 |
- |
|
 |
Power Funk Family |
20-Apr-2018 16:20 |
- |
|
 |
Prinze George |
20-Apr-2018 16:20 |
- |
|
 |
Pritam, JAM8 |
20-Apr-2018 16:20 |
- |
|
 |
Pussycat Dolls feat. Busta Rhymes |
20-Apr-2018 16:20 |
- |
|
 |
RSO |
20-Apr-2018 16:20 |
- |
|
 |
Ramos |
20-Apr-2018 16:20 |
- |
|
 |
Ramón Ayala y los Bravos del Norte |
20-Apr-2018 16:20 |
- |
|
 |
Rayna Gellert & Friends |
20-Apr-2018 16:20 |
- |
|
 |
Red Kite |
20-Apr-2018 16:20 |
- |
|
 |
Rias64 |
20-Apr-2018 16:20 |
- |
|
 |
Rossini, Verdi, Poulenc, Szymanowski |
20-Apr-2018 16:20 |
- |
|
 |
Russian Anonymous Choir |
20-Apr-2018 16:20 |
- |
|
 |
Ryan Caraveo |
20-Apr-2018 16:20 |
- |
|
 |
Saor Patrol |
20-Apr-2018 16:20 |
- |
|
 |
Satie; Philippe Entremont |
20-Apr-2018 16:20 |
- |
|
 |
Satisfy |
20-Apr-2018 16:20 |
- |
|
 |
Schubert, Krenek, Strauss, Trojahn; Katharina Konradi, Gerold Huber |
20-Apr-2018 16:20 |
- |
|
 |
Schubert; Lorin Maazel |
20-Apr-2018 16:20 |
- |
|
 |
Schubert; Sviatovslav Richter |
20-Apr-2018 16:20 |
- |
|
 |
Sean Bay |
20-Apr-2018 16:20 |
- |
|
 |
Sinobola |
20-Apr-2018 16:20 |
- |
|
 |
Soulreactive |
20-Apr-2018 16:20 |
- |
|
 |
Spoon+ |
20-Apr-2018 16:20 |
- |
|
 |
Stan Bush and Vince DiCola |
20-Apr-2018 16:20 |
- |
|
 |
Step High |
20-Apr-2018 16:20 |
- |
|
 |
Steve Gibbs |
20-Apr-2018 16:20 |
- |
|
 |
Subroto Roy Chowdhury, Steve Lacy |
20-Apr-2018 16:20 |
- |
|
 |
Sunmoonstar ⁄ Euglossine |
20-Apr-2018 16:20 |
- |
|
 |
Tamboor |
20-Apr-2018 16:20 |
- |
|
 |
Tasos Bougas |
20-Apr-2018 16:20 |
- |
|
 |
Televangel |
20-Apr-2018 16:20 |
- |
|
 |
The Angels |
20-Apr-2018 16:20 |
- |
|
 |
The Barberettes |
20-Apr-2018 16:20 |
- |
|
 |
The City Never Sleeps & Caitlin Stubbs |
20-Apr-2018 16:20 |
- |
|
 |
The Girls and Men of Canterbury Cathedral Choir |
20-Apr-2018 16:20 |
- |
|
 |
The Lone Crows |
20-Apr-2018 16:20 |
- |
|
 |
The Love-Birds |
20-Apr-2018 16:20 |
- |
|
 |
The Young Gods & Sinfonietta de Lausanne |
20-Apr-2018 16:20 |
- |
|
 |
The “5” Royales |
20-Apr-2018 16:20 |
- |
|
 |
Thermit |
20-Apr-2018 16:20 |
- |
|
 |
Thy Worshiper |
20-Apr-2018 16:20 |
- |
|
 |
Torn Down Units |
20-Apr-2018 16:20 |
- |
|
 |
Toña Montiel |
20-Apr-2018 16:20 |
- |
|
 |
Trent Reznor and Atticus Ross, Gustavo Santaolalla, Mogwai |
20-Apr-2018 16:20 |
- |
|
 |
Trío Los Panchos |
20-Apr-2018 16:20 |
- |
|
 |
VAN17INO6 |
20-Apr-2018 16:20 |
- |
|
 |
VOW WOW |
20-Apr-2018 16:20 |
- |
|
 |
Vanzo |
20-Apr-2018 16:20 |
- |
|
 |
Vienna Lusthouse |
20-Apr-2018 16:20 |
- |
|
 |
Vivaldi; Lorin Maazel, Patrice Fontanarosa, Régis Pasquier |
20-Apr-2018 16:20 |
- |
|
 |
Vizediktator |
20-Apr-2018 16:20 |
- |
|
 |
Voidthrone |
20-Apr-2018 16:20 |
- |
|
 |
Walter Frye; The Hilliard Ensemble |
20-Apr-2018 16:20 |
- |
|
 |
Webern, Carter, Varèse, Berio; Pierre Boulez, Ensemble intercontemporain, London Symphony Orchestra, New York Philharmonic |
20-Apr-2018 16:20 |
- |
|
 |
Who Knew |
20-Apr-2018 16:20 |
- |
|
 |
Wild Billy Childish & The Chatham Singers |
20-Apr-2018 16:20 |
- |
|
 |
Witold Lutosławski; Piotr Paleczny, Polish National Radio Symphony Orchestra (Katowice), Antoni Wit |
20-Apr-2018 16:20 |
- |
|
 |
Wolfgang Amadeus Mozart; Tapiola Sinfonietta, Jean‐Jacques Kantorow |
20-Apr-2018 16:20 |
- |
|
 |
Xanthochroid |
20-Apr-2018 16:20 |
- |
|
 |
Xehanort |
20-Apr-2018 16:20 |
- |
|
 |
Xzibit |
20-Apr-2018 16:20 |
- |
|
 |
Yiddishe Cup |
20-Apr-2018 16:20 |
- |
|
 |
Yluna Lab |
20-Apr-2018 16:20 |
- |
|
 |
Youth Youth Youth |
20-Apr-2018 16:20 |
- |
|
 |
Yunomi feat. 桃箱 |
20-Apr-2018 16:20 |
- |
|
 |
cLuMsY |
20-Apr-2018 16:20 |
- |
|
 |
gPUNKT |
20-Apr-2018 16:20 |
- |
|
 |
les troubadours des bruyères |
20-Apr-2018 16:20 |
- |
|
 |
Álfheimr |
20-Apr-2018 16:20 |
- |
|
 |
Åke 'Kråkan' Nilsson |
20-Apr-2018 16:20 |
- |
|
 |
ΣƶɦĂk |
20-Apr-2018 16:20 |
- |
|
 |
Баста |
20-Apr-2018 16:20 |
- |
|
 |
Игорь Николаев |
20-Apr-2018 16:20 |
- |
|
 |
Ксения Анестовна Георгиади |
20-Apr-2018 16:20 |
- |
|
 |
じゃがたら |
20-Apr-2018 16:20 |
- |
|
 |
内海和子 |
20-Apr-2018 16:20 |
- |
|
 |
周國賢 |
20-Apr-2018 16:20 |
- |
|
 |
在知 |
20-Apr-2018 16:20 |
- |
|
 |
寺内タケシとバニーズ |
20-Apr-2018 16:20 |
- |
|
 |
山本理沙 |
20-Apr-2018 16:20 |
- |
|
 |
雪楓Yuki, 落羽(Extern), 飆高音P, J2J, いくせん, Lain Hikaru&J.H.指揮官 |
20-Apr-2018 16:20 |
- |
|
|