![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
(ghost) |
20-Apr-2018 16:20 |
- |
|
|
138 |
20-Apr-2018 16:20 |
- |
|
|
1914 |
20-Apr-2018 16:20 |
- |
|
|
A$AP Rocky feat. BlocBoy JB |
20-Apr-2018 16:20 |
- |
|
|
AT0SHIMA 3RR0R |
20-Apr-2018 16:20 |
- |
|
|
Acrid Abeyance |
20-Apr-2018 16:20 |
- |
|
|
Aghast! |
20-Apr-2018 16:20 |
- |
|
|
Alan Hovhaness; Central Washington University Wind Ensemble, Larry Gookin, Keith Brion, Mark Goodenberger |
20-Apr-2018 16:20 |
- |
|
|
Alaska |
20-Apr-2018 16:20 |
- |
|
|
Alcione |
20-Apr-2018 16:20 |
- |
|
|
Alejandro Vera Blues |
20-Apr-2018 16:20 |
- |
|
|
Alessandra Celletti |
20-Apr-2018 16:20 |
- |
|
|
Alic |
20-Apr-2018 16:20 |
- |
|
|
Alireza Ghomayshi |
20-Apr-2018 16:20 |
- |
|
|
Alkibar Gignor |
20-Apr-2018 16:20 |
- |
|
|
All Them Witches |
20-Apr-2018 16:20 |
- |
|
|
Altar of Betelgeuze |
20-Apr-2018 16:20 |
- |
|
|
Animal Drive |
20-Apr-2018 16:20 |
- |
|
|
Anja & Wilhelm Tell Boys |
20-Apr-2018 16:20 |
- |
|
|
Anon |
20-Apr-2018 16:20 |
- |
|
|
Bad Riders |
20-Apr-2018 16:20 |
- |
|
|
Balladur |
20-Apr-2018 16:20 |
- |
|
|
Bear McCreary |
20-Apr-2018 16:20 |
- |
|
|
Bernie Senensky, Gene Perla, Ben Riley |
20-Apr-2018 16:20 |
- |
|
|
Big Gus and Swampadelic |
20-Apr-2018 16:20 |
- |
|
|
Black Moth |
20-Apr-2018 16:20 |
- |
|
|
Blee vs ClassyMenace |
20-Apr-2018 16:20 |
- |
|
|
Blinddryve |
20-Apr-2018 16:20 |
- |
|
|
Blue Sky Black Death presents The Holocaust |
20-Apr-2018 16:20 |
- |
|
|
Bonelang |
20-Apr-2018 16:20 |
- |
|
|
Brahms, Schubert; Silvia Chiesa, Maurizio Baglini |
20-Apr-2018 16:20 |
- |
|
|
Brett Anderson |
20-Apr-2018 16:20 |
- |
|
|
Bridgette Bryant |
20-Apr-2018 16:20 |
- |
|
|
Buck Biloxi and The Fucks ⁄ Microsoft Paint |
20-Apr-2018 16:20 |
- |
|
|
Bus Stop |
20-Apr-2018 16:20 |
- |
|
|
Charles‐Marie Widor, Louis Vierne; Simon Preston |
20-Apr-2018 16:20 |
- |
|
|
Chekara |
20-Apr-2018 16:20 |
- |
|
|
Cherry aka BreakNtune & Da Phunk |
20-Apr-2018 16:20 |
- |
|
|
Claire Bergerault |
20-Apr-2018 16:20 |
- |
|
|
Coronel |
20-Apr-2018 16:20 |
- |
|
|
Corpora |
20-Apr-2018 16:20 |
- |
|
|
Cosmic Lights |
20-Apr-2018 16:20 |
- |
|
|
Coverdale • Page |
20-Apr-2018 16:20 |
- |
|
|
Crazy As Pinoy |
20-Apr-2018 16:20 |
- |
|
|
César Franck; Wiener Philharmoniker, Paul Crossley, Carlo Maria Giulini |
20-Apr-2018 16:20 |
- |
|
|
C‐Dubb Presents Mac Reese |
20-Apr-2018 16:20 |
- |
|
|
DG 307 |
20-Apr-2018 16:20 |
- |
|
|
Da Uptown Crew |
20-Apr-2018 16:20 |
- |
|
|
Darediablo |
20-Apr-2018 16:20 |
- |
|
|
Dario Campeotto |
20-Apr-2018 16:20 |
- |
|
|
Dave McKean |
20-Apr-2018 16:20 |
- |
|
|
David Gorman |
20-Apr-2018 16:20 |
- |
|
|
David McNeil |
20-Apr-2018 16:20 |
- |
|
|
David Smith & Rebecca Vicary |
20-Apr-2018 16:20 |
- |
|
|
Daydream XI |
20-Apr-2018 16:20 |
- |
|
|
Dear Pariah |
20-Apr-2018 16:20 |
- |
|
|
Degial |
20-Apr-2018 16:20 |
- |
|
|
Dozer |
20-Apr-2018 16:20 |
- |
|
|
Eden Studios |
20-Apr-2018 16:20 |
- |
|
|
Elgar, Brahms; Leopold Stokowski |
20-Apr-2018 16:20 |
- |
|
|
Elinor Frey, David Fung |
20-Apr-2018 16:20 |
- |
|
|
Erik Satie; Johannes Cernota |
20-Apr-2018 16:20 |
- |
|
|
Eskapisten |
20-Apr-2018 16:20 |
- |
|
|
Falloch |
20-Apr-2018 16:20 |
- |
|
|
Fates Warning |
20-Apr-2018 16:20 |
- |
|
|
Field Report |
20-Apr-2018 16:20 |
- |
|
|
Fourteen 14 ⁄ Pianonegro |
20-Apr-2018 16:20 |
- |
|
|
Fox Academy |
20-Apr-2018 16:20 |
- |
|
|
Franz Schubert; Andreas Staier, Daniel Sepec, Roel Dieltiens |
20-Apr-2018 16:20 |
- |
|
|
Freddie Gibbs |
20-Apr-2018 16:20 |
- |
|
|
Gabriel Fauré; Alban Gerhardt, Cécile Licad |
20-Apr-2018 16:20 |
- |
|
|
Gareth Thomas |
20-Apr-2018 16:20 |
- |
|
|
Gary Numan |
20-Apr-2018 16:20 |
- |
|
|
Gary Numan & Ade Fenton |
20-Apr-2018 16:20 |
- |
|
|
Globi |
20-Apr-2018 16:20 |
- |
|
|
Gruppo di Improvvisazione Nuova Consonanza |
20-Apr-2018 16:20 |
- |
|
|
Gustav Holst & Sir William Walton |
20-Apr-2018 16:20 |
- |
|
|
Göteborgs Symfoniker, Neeme Järvi |
20-Apr-2018 16:20 |
- |
|
|
Halasan Bazar |
20-Apr-2018 16:20 |
- |
|
|
Harper Lee read by Sissy Spacek |
20-Apr-2018 16:20 |
- |
|
|
Headhunterz vs Wildstylez |
20-Apr-2018 16:20 |
- |
|
|
Henny Huisman en Soundmixers Voor Zonnebloem |
20-Apr-2018 16:20 |
- |
|
|
Hernando |
20-Apr-2018 16:20 |
- |
|
|
Hidrolic West feat. C-Bo, King Locust, Twan G, P3 & Shoddy Boi |
20-Apr-2018 16:20 |
- |
|
|
Hindemith; Dietrich Fischer‐Dieskau, Elisabeth Söderström, Leonore Kirschstein, Donald Grobe, Joseph Keilberth |
20-Apr-2018 16:20 |
- |
|
|
Homo-Demen |
20-Apr-2018 16:20 |
- |
|
|
Iiro Rantala |
20-Apr-2018 16:20 |
- |
|
|
Ill Conscious |
20-Apr-2018 16:20 |
- |
|
|
Illumenium |
20-Apr-2018 16:20 |
- |
|
|
Incise |
20-Apr-2018 16:20 |
- |
|
|
Irving Joseph |
20-Apr-2018 16:20 |
- |
|
|
J-Ax & Fedez |
20-Apr-2018 16:20 |
- |
|
|
J.J. Johnson ⁄ Dominic Frontiere |
20-Apr-2018 16:20 |
- |
|
|
J.S. Bach; Marie‐Claire Alain |
20-Apr-2018 16:20 |
- |
|
|
JJUUJJUU |
20-Apr-2018 16:20 |
- |
|
|
Jason Nevins vs. The Krew |
20-Apr-2018 16:20 |
- |
|
|
Jawbone |
20-Apr-2018 16:20 |
- |
|
|
Jelly Roll Morton |
20-Apr-2018 16:20 |
- |
|
|
Jerry O’Sullivan |
20-Apr-2018 16:20 |
- |
|
|
Jerry Raye featuring Fenwyck |
20-Apr-2018 16:20 |
- |
|
|
Jochen Feucht Quartett |
20-Apr-2018 16:20 |
- |
|
|
Joe Pass & J.J. Johnson |
20-Apr-2018 16:20 |
- |
|
|
Johann Jacob Froberger; Bob van Asperen |
20-Apr-2018 16:20 |
- |
|
|
Johann Sebastian Bach, César Franck; Michael Murray |
20-Apr-2018 16:20 |
- |
|
|
John Cage, Sylvano Bussotti; Paolo Carlini, Mauro Castellano |
20-Apr-2018 16:20 |
- |
|
|
John Duncan & Cosey Fanni-Tutti & Chris Carter |
20-Apr-2018 16:20 |
- |
|
|
Johnny Carbonaras |
20-Apr-2018 16:20 |
- |
|
|
Joseph Haydn; Stefano Montanari, Accademia Bizantina & Ottavio Dantone |
20-Apr-2018 16:20 |
- |
|
|
Josh Lawrence |
20-Apr-2018 16:20 |
- |
|
|
Junior C Reaction |
20-Apr-2018 16:20 |
- |
|
|
Kabani |
20-Apr-2018 16:20 |
- |
|
|
Kevin Dippold & The Float Associates |
20-Apr-2018 16:20 |
- |
|
|
Kinto Sol |
20-Apr-2018 16:20 |
- |
|
|
Kodak Black & Plies |
20-Apr-2018 16:20 |
- |
|
|
Kuranes |
20-Apr-2018 16:20 |
- |
|
|
La Bouquet |
20-Apr-2018 16:20 |
- |
|
|
Lacertilia |
20-Apr-2018 16:20 |
- |
|
|
Lake Michigan |
20-Apr-2018 16:20 |
- |
|
|
Lana Del Rey |
20-Apr-2018 16:20 |
- |
|
|
Leg Puppy |
20-Apr-2018 16:20 |
- |
|
|
Les Tontons Flingueurs |
20-Apr-2018 16:20 |
- |
|
|
Levent Yüksel |
20-Apr-2018 16:20 |
- |
|
|
Lex van Someren |
20-Apr-2018 16:20 |
- |
|
|
Licht |
20-Apr-2018 16:20 |
- |
|
|
Liesbeth List & Ramses Shaffy |
20-Apr-2018 16:20 |
- |
|
|
Lil Xan |
20-Apr-2018 16:20 |
- |
|
|
Ludwig Sebus |
20-Apr-2018 16:20 |
- |
|
|
Lyra's Legacy |
20-Apr-2018 16:20 |
- |
|
|
Mahler; Christoph von Dohnányi, Dawn Upshaw, Cleveland Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Mana Source |
20-Apr-2018 16:20 |
- |
|
|
Manian |
20-Apr-2018 16:20 |
- |
|
|
Manuel Mucua |
20-Apr-2018 16:20 |
- |
|
|
Marie-José |
20-Apr-2018 16:20 |
- |
|
|
Mario Bautista & De La Ghetto |
20-Apr-2018 16:20 |
- |
|
|
Martire⁄Throneum |
20-Apr-2018 16:20 |
- |
|
|
Merle Haggard & The Strangers |
20-Apr-2018 16:20 |
- |
|
|
Michel Delpech |
20-Apr-2018 16:20 |
- |
|
|
Michel Petrucciani, Bob Malach |
20-Apr-2018 16:20 |
- |
|
|
Milt Jackson, Al Cohn, J.J. Johnson, Kai Winding |
20-Apr-2018 16:20 |
- |
|
|
Mirage |
20-Apr-2018 16:20 |
- |
|
|
Mordecai Mapper ⁄Boston Brass Band ⁄ Cowz II |
20-Apr-2018 16:20 |
- |
|
|
Mosaic |
20-Apr-2018 16:20 |
- |
|
|
Mozart; The Italian Quartet with Antoine de Bavier |
20-Apr-2018 16:20 |
- |
|
|
My Girl The River |
20-Apr-2018 16:20 |
- |
|
|
NAK Trio |
20-Apr-2018 16:20 |
- |
|
|
NSD |
20-Apr-2018 16:20 |
- |
|
|
Nate Jones Band |
20-Apr-2018 16:20 |
- |
|
|
Neonsol |
20-Apr-2018 16:20 |
- |
|
|
Neutro Shorty |
20-Apr-2018 16:20 |
- |
|
|
Nice Cold Nation |
20-Apr-2018 16:20 |
- |
|
|
Nick Jonas feat. Anne‐Marie & Mike Posner |
20-Apr-2018 16:20 |
- |
|
|
Nicole Rieu |
20-Apr-2018 16:20 |
- |
|
|
Nocturnal Triumph |
20-Apr-2018 16:20 |
- |
|
|
North Texas Wind Symphony, Eugene Corporon |
20-Apr-2018 16:20 |
- |
|
|
Oliver Twizt feat. TRYON |
20-Apr-2018 16:20 |
- |
|
|
Olivier Messiaen; Daniel Beilschmidt |
20-Apr-2018 16:20 |
- |
|
|
Orchid Fixation |
20-Apr-2018 16:20 |
- |
|
|
Orlando Gibbons; Jordi Savall, Christophe Coin, Sergi Casademunt, Johannes Sonnleitner |
20-Apr-2018 16:20 |
- |
|
|
Oscar Woods & Black Ace |
20-Apr-2018 16:20 |
- |
|
|
Our Place of Worship Is Silence |
20-Apr-2018 16:20 |
- |
|
|
Palestrina; Pro Cantione Antiqua, Bruno Turner |
20-Apr-2018 16:20 |
- |
|
|
Pantastic Steelband |
20-Apr-2018 16:20 |
- |
|
|
Pat Cash |
20-Apr-2018 16:20 |
- |
|
|
Paul Corley |
20-Apr-2018 16:20 |
- |
|
|
Perception Cleanse Perception |
20-Apr-2018 16:20 |
- |
|
|
Phenomenal Sun |
20-Apr-2018 16:20 |
- |
|
|
Philippe Jacquis |
20-Apr-2018 16:20 |
- |
|
|
Pierre Akendengué |
20-Apr-2018 16:20 |
- |
|
|
Pol Nada |
20-Apr-2018 16:20 |
- |
|
|
Power Funk Family |
20-Apr-2018 16:20 |
- |
|
|
Prinze George |
20-Apr-2018 16:20 |
- |
|
|
Pritam, JAM8 |
20-Apr-2018 16:20 |
- |
|
|
Pussycat Dolls feat. Busta Rhymes |
20-Apr-2018 16:20 |
- |
|
|
RSO |
20-Apr-2018 16:20 |
- |
|
|
Ramos |
20-Apr-2018 16:20 |
- |
|
|
Ramón Ayala y los Bravos del Norte |
20-Apr-2018 16:20 |
- |
|
|
Rayna Gellert & Friends |
20-Apr-2018 16:20 |
- |
|
|
Red Kite |
20-Apr-2018 16:20 |
- |
|
|
Rias64 |
20-Apr-2018 16:20 |
- |
|
|
Rossini, Verdi, Poulenc, Szymanowski |
20-Apr-2018 16:20 |
- |
|
|
Russian Anonymous Choir |
20-Apr-2018 16:20 |
- |
|
|
Ryan Caraveo |
20-Apr-2018 16:20 |
- |
|
|
Saor Patrol |
20-Apr-2018 16:20 |
- |
|
|
Satie; Philippe Entremont |
20-Apr-2018 16:20 |
- |
|
|
Satisfy |
20-Apr-2018 16:20 |
- |
|
|
Schubert, Krenek, Strauss, Trojahn; Katharina Konradi, Gerold Huber |
20-Apr-2018 16:20 |
- |
|
|
Schubert; Lorin Maazel |
20-Apr-2018 16:20 |
- |
|
|
Schubert; Sviatovslav Richter |
20-Apr-2018 16:20 |
- |
|
|
Sean Bay |
20-Apr-2018 16:20 |
- |
|
|
Sinobola |
20-Apr-2018 16:20 |
- |
|
|
Soulreactive |
20-Apr-2018 16:20 |
- |
|
|
Spoon+ |
20-Apr-2018 16:20 |
- |
|
|
Stan Bush and Vince DiCola |
20-Apr-2018 16:20 |
- |
|
|
Step High |
20-Apr-2018 16:20 |
- |
|
|
Steve Gibbs |
20-Apr-2018 16:20 |
- |
|
|
Subroto Roy Chowdhury, Steve Lacy |
20-Apr-2018 16:20 |
- |
|
|
Sunmoonstar ⁄ Euglossine |
20-Apr-2018 16:20 |
- |
|
|
Tamboor |
20-Apr-2018 16:20 |
- |
|
|
Tasos Bougas |
20-Apr-2018 16:20 |
- |
|
|
Televangel |
20-Apr-2018 16:20 |
- |
|
|
The Angels |
20-Apr-2018 16:20 |
- |
|
|
The Barberettes |
20-Apr-2018 16:20 |
- |
|
|
The City Never Sleeps & Caitlin Stubbs |
20-Apr-2018 16:20 |
- |
|
|
The Girls and Men of Canterbury Cathedral Choir |
20-Apr-2018 16:20 |
- |
|
|
The Lone Crows |
20-Apr-2018 16:20 |
- |
|
|
The Love-Birds |
20-Apr-2018 16:20 |
- |
|
|
The Young Gods & Sinfonietta de Lausanne |
20-Apr-2018 16:20 |
- |
|
|
The “5” Royales |
20-Apr-2018 16:20 |
- |
|
|
Thermit |
20-Apr-2018 16:20 |
- |
|
|
Thy Worshiper |
20-Apr-2018 16:20 |
- |
|
|
Torn Down Units |
20-Apr-2018 16:20 |
- |
|
|
Toña Montiel |
20-Apr-2018 16:20 |
- |
|
|
Trent Reznor and Atticus Ross, Gustavo Santaolalla, Mogwai |
20-Apr-2018 16:20 |
- |
|
|
Trío Los Panchos |
20-Apr-2018 16:20 |
- |
|
|
VAN17INO6 |
20-Apr-2018 16:20 |
- |
|
|
VOW WOW |
20-Apr-2018 16:20 |
- |
|
|
Vanzo |
20-Apr-2018 16:20 |
- |
|
|
Vienna Lusthouse |
20-Apr-2018 16:20 |
- |
|
|
Vivaldi; Lorin Maazel, Patrice Fontanarosa, Régis Pasquier |
20-Apr-2018 16:20 |
- |
|
|
Vizediktator |
20-Apr-2018 16:20 |
- |
|
|
Voidthrone |
20-Apr-2018 16:20 |
- |
|
|
Walter Frye; The Hilliard Ensemble |
20-Apr-2018 16:20 |
- |
|
|
Webern, Carter, Varèse, Berio; Pierre Boulez, Ensemble intercontemporain, London Symphony Orchestra, New York Philharmonic |
20-Apr-2018 16:20 |
- |
|
|
Who Knew |
20-Apr-2018 16:20 |
- |
|
|
Wild Billy Childish & The Chatham Singers |
20-Apr-2018 16:20 |
- |
|
|
Witold Lutosławski; Piotr Paleczny, Polish National Radio Symphony Orchestra (Katowice), Antoni Wit |
20-Apr-2018 16:20 |
- |
|
|
Wolfgang Amadeus Mozart; Tapiola Sinfonietta, Jean‐Jacques Kantorow |
20-Apr-2018 16:20 |
- |
|
|
Xanthochroid |
20-Apr-2018 16:20 |
- |
|
|
Xehanort |
20-Apr-2018 16:20 |
- |
|
|
Xzibit |
20-Apr-2018 16:20 |
- |
|
|
Yiddishe Cup |
20-Apr-2018 16:20 |
- |
|
|
Yluna Lab |
20-Apr-2018 16:20 |
- |
|
|
Youth Youth Youth |
20-Apr-2018 16:20 |
- |
|
|
Yunomi feat. 桃箱 |
20-Apr-2018 16:20 |
- |
|
|
cLuMsY |
20-Apr-2018 16:20 |
- |
|
|
gPUNKT |
20-Apr-2018 16:20 |
- |
|
|
les troubadours des bruyères |
20-Apr-2018 16:20 |
- |
|
|
Álfheimr |
20-Apr-2018 16:20 |
- |
|
|
Åke 'Kråkan' Nilsson |
20-Apr-2018 16:20 |
- |
|
|
ΣƶɦĂk |
20-Apr-2018 16:20 |
- |
|
|
Баста |
20-Apr-2018 16:20 |
- |
|
|
Игорь Николаев |
20-Apr-2018 16:20 |
- |
|
|
Ксения Анестовна Георгиади |
20-Apr-2018 16:20 |
- |
|
|
じゃがたら |
20-Apr-2018 16:20 |
- |
|
|
内海和子 |
20-Apr-2018 16:20 |
- |
|
|
周國賢 |
20-Apr-2018 16:20 |
- |
|
|
在知 |
20-Apr-2018 16:20 |
- |
|
|
寺内タケシとバニーズ |
20-Apr-2018 16:20 |
- |
|
|
山本理沙 |
20-Apr-2018 16:20 |
- |
|
|
雪楓Yuki, 落羽（Extern）, 飆高音P, J2J, いくせん, Lain Hikaru&J.H.指揮官 |
20-Apr-2018 16:20 |
- |
|
|
|---|